| Verifiedfields: | changed |
| Watchedfields: | changed |
| Verifiedrevid: | 408916457 |
| Iupac Name: | 4-[[4-butyl-3,5-dioxo-1,2-di(phenyl)pyrazolidin-4-yl]methoxy]-4-oxobutanoic acid |
| Cas Number: | 27470-51-5 |
| Atc Prefix: | M02 |
| Atc Suffix: | AA22 |
| Pubchem: | 5362 |
| Unii: | 86TDZ5WP2B |
| Kegg: | D01289 |
| Chembl: | 1414320 |
| Chemspiderid: | 5169 |
| Smiles: | O=C(O)CCC(=O)OCC2(C(=O)N(c1ccccc1)N(C2=O)c3ccccc3)CCCC |
| Stdinchi: | 1S/C24H26N2O6/c1-2-3-16-24(17-32-21(29)15-14-20(27)28)22(30)25(18-10-6-4-7-11-18)26(23(24)31)19-12-8-5-9-13-19/h4-13H,2-3,14-17H2,1H3,(H,27,28) |
| Stdinchikey: | ONWXNHPOAGOMTG-UHFFFAOYSA-N |
| C: | 24 |
| H: | 26 |
| N: | 2 |
| O: | 6 |
Suxibuzone is an analgesic used for joint and muscular pain. It is a prodrug of the non-steroidal anti-inflammatory drug (NSAID) phenylbutazone,[1] and is commonly used in horses.[2]