| Drug Name: | Speciociliatine |
| Legal Us: | unscheduled |
| Iupac Name: | methyl (E)-2-[(2S,3S,12bR)-3-ethyl-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| Cas Number: | 14382-79-7 |
| Pubchem: | 5376107 |
| Chemspiderid: | 20124314 |
| Unii: | M3NN8Z8ZJW |
| Chembl: | 4546925 |
| C: | 23 |
| H: | 30 |
| N: | 2 |
| O: | 4 |
| Smiles: | CC[C@@H]1CN2CCC3=C([C@H]2C[C@@H]1/C(=C\OC)/C(=O)OC)NC4=C3C(=CC=C4)OC |
| Stdinchi: | 1S/C23H30N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,13-14,16,19,24H,5,9-12H2,1-4H3/b17-13+/t14-,16+,19-/m1/s1 |
| Stdinchikey: | LELBFTMXCIIKKX-MYLQJJOTSA-N |
| Melting Notes: | 104 °C[1] |
Speciociliatine is a major alkaloid of the plant Mitragyna speciosa, commonly known as kratom. It is a stereoisomer of Mitragynine and constitutes 0.00156 - 2.9% of the dried leaf material.
Speciociliatine has found to be a ligand of the mu and kappa opioid receptors, however findings are varied as to whether it functions as an agonist or a competitive antagonist at those sites.
A preliminary pharmacokinetic analysis in male Sprague Dawley rats determined the elimination half-life of Speciociliatine to be 2.6 - 5 hours and the absolute bioavailability to be 20.7% (at an oral dose of 20 mg/kg).