| Tradename: | Glycophos |
| Pregnancy Au Comment: | Exempt[1] |
| Routes Of Administration: | Intravenous infusion |
| Atc Prefix: | B05 |
| Atc Suffix: | XA14 |
| Legal Au: | Unscheduled |
| Legal Au Comment: | [2] |
| Cas Number: | 1334-74-3 |
| Cas Number2: | 55073-41-1 |
| Pubchem: | 22251426 |
| Drugbank: | DB09561 |
| Chemspiderid: | 14071 |
| Unii: | YP1H63LJ2K |
| Unii2: | RCS9EQ01V4 |
| Kegg: | D10489 |
| Chembl: | 3040581 |
| Iupac Name: | disodium 3-(phosphonooxy)propane-1,2-diol |
| C: | 3 |
| H: | 7 |
| Na: | 2 |
| O: | 6 |
| P: | 1 |
| Smiles: | [Na+].[Na+].OCC(O)COP([O-])([O-])=O |
| Stdinchi: | 1S/C3H9O6P.2Na/c4-1-3(5)2-9-10(6,7)8;;/h3-5H,1-2H2,(H2,6,7,8);;/q;2*+1/p-2 |
| Stdinchikey: | GEKBIENFFVFKRG-UHFFFAOYSA-L |
| Stdinchikey2: | OFNNKPAERNWEDD-UHFFFAOYSA-L |
| Melting Point: | 98 |
| Melting High: | 100 |
| Solubility: | very soluble |
Sodium glycerophosphate, sold under the brand name Glycophos, is a medication used to supplement phosphate. It is administered via intravenous infusion.
Sodium glycerophosphate is an organic phosphate salt.[3]
It was approved for medical use in Australia in November 2019.[4] [5]
It is an unapproved medication in the United States that was used as a substitute for inorganic phosphate during a drug shortage.[6]
The substance is a mixture of disodium glycerol 1- and 2-phosphates, which have different amounts of water of crystallization; the total amount is H2O per glycerol phosphate molecule. It is a white to off-white powder which may or may not be crystalline, has no discernible odor and tastes salty. It melts at NaNC and decomposes at 130C. Aqueous solutions have a pH of about 9.5.[7]