| Width: | 200px |
| Width2: | 180px |
| Type: | combo |
| Component1: | Simnotrelvir |
| Class1: | SARS-CoV-2 3CLpro inhibitor |
| Component2: | Ritonavir |
| Class2: | Protease inhibitor |
| Tradename: | 先诺欣 (Xiannuoxin) |
| Pregnancy Category: | Contraindicated (CN) |
| Routes Of Administration: | Oral |
| Legal Status: | Rx in China |
| Drug Name: | Simnotrelvir |
| Routes Of Administration: | Oral |
| Class: | SARS-CoV-2 3CLpro inhibitor |
| Legal Status: | Not approved on its own |
| Protein Bound: | 72.5% |
| Metabolism: | hepatic (CYP3A) |
| Elimination Half-Life: | 3.1 h; 4.1 h with ritonavir[1] |
| Excretion: | urine (55.4%), feces (36.7%) |
| Pubchem: | 168476146 |
| Synonyms: | SIM0417, SSD8432 |
| Iupac Name: | (8S)-N-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-7-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
| C: | 22 |
| H: | 30 |
| F: | 3 |
| N: | 5 |
| O: | 4 |
| S: | 2 |
| Smiles: | CC(C)(C)[C@@H](C(=O)N1CC2(C[C@H]1C(=O)N[C@@H](C[C@@H]3CCNC3=O)C#N)SCCS2)NC(=O)C(F)(F)F |
| Stdinchi: | InChI=1S/C22H30F3N5O4S2/c1-20(2,3)15(29-19(34)22(23,24)25)18(33)30-11-21(35-6-7-36-21)9-14(30)17(32)28-13(10-26)8-12-4-5-27-16(12)31/h12-15H,4-9,11H2,1-3H3,(H,27,31)(H,28,32)(H,29,34)/t12-,13-,14-,15+/m0/s1 |
| Stdinchikey: | LQBRGTAIBBFUJJ-ZQDZILKHSA-N |
Simnotrelvir/ritonavir (trade name Xiannuoxin) is a pharmaceutical drug used for the treatment of COVID-19.[2] Simnotrelvir/ritonavir is a combination drug of simnotrelvir, an inhibitor of SARS-CoV-2 3CLpro, and ritonavir,[3] a CYP3A inhibitor.
It was developed by Simcere Pharmaceutical and conditionally approved in China by the National Medical Products Administration (NMPA) in January 2023.[4] Results for the phase Ib trial are available.[5] In a phase II/III trial, it reduced the duration of symptoms by a median of 36 hours compared to placebo.[6]