| Iupac Name: | 3-[(1''S'')-1-Imidazo[1,2-a]pyridin-6-ylethyl]-5-(1-methylpyrazol-4-yl)triazolo[4,5-b]pyrazine |
| Cas Number: | 1313725-88-0 |
| Unii: | 2A2DA6857R |
| Chemspiderid: | 34501055 |
| Chebi: | 231369 |
| Kegg: | D11139 |
| Synonyms: | Volitinib |
| C: | 17 |
| H: | 15 |
| N: | 9 |
| Stdinchi: | 1S/C17H15N9/c1-11(12-3-4-15-18-5-6-25(15)10-12)26-17-16(22-23-26)19-8-14(21-17)13-7-20-24(2)9-13/h3-11H,1-2H3/t11-/m0/s1 |
| Stdinchikey: | XYDNMOZJKOGZLS-NSHDSACASA-N |
| Smiles: | C[C@@H](c1ccc2nccn2c1)n1nnc2ncc(-c3cnn(C)c3)nc21 |
Savolitinib is an experimental small molecule inhibitor of c-Met. It is being investigated for the treatment of cancer by AstraZeneca.[1] It is in phase II clinical trials for adenocarcinoma, non-small cell lung cancer, and renal cell carcinoma.[2] It has been given conditional approval for these indication in China.[3]