| Routes Of Administration: | Inhalation, intravenous |
| Class: | Bronchodilator |
| Cas Number: | 18910-65-1 |
| Pubchem: | 86805 |
| Chemspiderid: | 78303 |
| Unii: | Q56SEY8X9J |
| Kegg: | C11771 |
| Chembl: | 2107072 |
| Synonyms: | AH-3923; AHR-3929; 1-(4-hydroxy-3-(hydroxymethyl)phenyl)-2-(4-methoxy-α-methylphenethylamino)ethanol |
| Iupac Name: | 4-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]-2-(hydroxymethyl)phenol |
| C: | 19 |
| H: | 25 |
| N: | 1 |
| O: | 4 |
| Smiles: | CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)CO)O |
| Stdinchi: | 1S/C19H25NO4/c1-13(9-14-3-6-17(24-2)7-4-14)20-11-19(23)15-5-8-18(22)16(10-15)12-21/h3-8,10,13,19-23H,9,11-12H2,1-2H3 |
| Stdinchikey: | VPMWDFRZSIMDKW-UHFFFAOYSA-N |
Salmefamol (; developmental code name AH-3923) is a drug of the phenethylamine and amphetamine families described as a bronchodilator which was never marketed.[1] It is a β-adrenergic receptor agonist with some selectivity for the β2-adrenergic receptor[2] [3] and has been described as a "sister compound" to salbutamol.[4] However, the drug is more potent (1.5-fold), longer-acting (6hours), and more lipophilic in comparison to salbutamol.[5] [6] It was intended for inhalational or intravenous administration. Salmefamol was first described in the literature by 1968.