| Iupac Name: | (2R,4S)-5-(4-Biphenylyl)-4-[(3-carboxypropanoyl)amino]-2-methylpentanoic acid |
| Cas Number: | 149709-44-4 |
| Atc Prefix: | none |
| Pubchem: | 10430040 |
| Unii: | SPI5PBF81S |
| Chembl: | 417007 |
| Chemspiderid: | 8605468 |
| Synonyms: | LBQ657 |
| Pdb Ligand: | 6LD |
| C: | 22 |
| H: | 25 |
| N: | 1 |
| O: | 5 |
| Smiles: | C[C@H](C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O)C(=O)O |
| Stdinchi: | 1S/C22H25NO5/c1-15(22(27)28)13-19(23-20(24)11-12-21(25)26)14-16-7-9-18(10-8-16)17-5-3-2-4-6-17/h2-10,15,19H,11-14H2,1H3,(H,23,24)(H,25,26)(H,27,28)/t15-,19+/m1/s1 |
| Stdinchikey: | DOBNVUFHFMVMDB-BEFAXECRSA-N |
Sacubitrilat (INN; or LBQ657) is the active metabolite of the antihypertensive drug sacubitril, which is used in the treatment of heart failure.