Synonyms: | 3β-Tropanol; 1αH,5αH-Tropan-3β-ol |
Iupac Name: | (1R,3R,5S)-8-Methyl-8-azabicyclo[3.2.1]octan-3-ol |
Cas Number: | 135-97-7 |
Pubchem: | 449293 |
Unii: | L9Q7Z9D09L |
Chebi: | 15742 |
Chembl: | 1235490 |
C: | 8 |
H: | 15 |
N: | 1 |
O: | 1 |
Smiles: | CN1[C@@H]2CC[C@H]1C[C@@H](C2)O |
Stdinchi: | 1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8- |
Stdinchikey: | CYHOMWAPJJPNMW-RNLVFQAGSA-N |
Pseudotropine (3β-tropanol, ψ-tropine, 3-pseudotropanol, or PTO) is a derivative of tropane and an isomer of tropine. Pseudotropine can be found in the Coca plant along with several other alkaloids [1]