| Synonyms: | Ormethoprim |
| Cas Number: | 6981-18-6 |
| Pubchem: | 23418 |
| Chemspiderid: | 21899 |
| Kegg: | D05273 |
| Unii: | M3EFS94984 |
| Chebi: | 94553 |
| Chembl: | 494760 |
| Iupac Name: | 5-[(4,5-Dimethoxy-2-methylphenyl)methyl]pyrimidine-2,4-diamine |
| Stdinchi: | 1S/C14H18N4O2/c1-8-4-11(19-2)12(20-3)6-9(8)5-10-7-17-14(16)18-13(10)15/h4,6-7H,5H2,1-3H3,(H4,15,16,17,18) |
| Stdinchikey: | KEEYRKYKLYARHO-UHFFFAOYSA-N |
| Smiles: | CC1=CC(=C(C=C1CC2=CN=C(N=C2N)N)OC)OC |
| C: | 14 |
| H: | 18 |
| N: | 4 |
| O: | 2 |
Ormetoprim is an antibiotic used in veterinary medicine. Typically it is used in combination with sulfadimethoxine, and it is used in the poultry[1] and aquaculture industries.[2]
Ormetoprim, like other diaminopyrimidines such as trimethoprim, inhibits the reduction of dihydrofolic acid to tetrahydrofolic acid by bacterial cells.[3]