| Verifiedfields: | changed |
| Watchedfields: | changed |
| Verifiedrevid: | 449584902 |
| Iupac Name: | 2-[{1-[1-(4-Fluorobenzyl)-1''H''-benzimidazol-2-yl]piperidin-4-yl}(methyl)amino]pyrimidin-4(1H)-one |
| Legal Uk: | POM |
| Routes Of Administration: | By mouth (tablets) |
| Cas Number: | 108612-45-9 |
| Atc Prefix: | R06 |
| Atc Suffix: | AX25 |
| Pubchem: | 65906 |
| Unii: | 244O1F90NA |
| Kegg: | D01117 |
| Chembl: | 94454 |
| Chemspiderid: | 59315 |
| C: | 24 |
| H: | 25 |
| F: | 1 |
| N: | 6 |
| O: | 1 |
| Smiles: | CN(C1CCN(CC1)C2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F)C5=NC=CC(=O)N5 |
| Stdinchi: | 1S/C24H25FN6O/c1-29(23-26-13-10-22(32)28-23)19-11-14-30(15-12-19)24-27-20-4-2-3-5-21(20)31(24)16-17-6-8-18(25)9-7-17/h2-10,13,19H,11-12,14-16H2,1H3,(H,26,28,32) |
| Stdinchikey: | PVLJETXTTWAYEW-UHFFFAOYSA-N |
Mizolastine (Mizollen) is a once-daily, non-sedating antihistamine. It blocks H1 receptors and is commonly fast-acting.[1] It does not prevent the actual release of histamine from mast cells, it only prevents histamine from binding to receptors. Side effects can include dry mouth and throat.[2]