| Tradename: | Lymphazurin |
| Dailymedid: | Isosulfan blue |
| Routes Of Administration: | Subcutaneous |
| Atc Prefix: | None |
| Legal Us: | Rx-only |
| Legal Us Comment: | [1] |
| Index2 Label: | inner salt |
| Cas Number: | 68238-36-8 |
| Cas Number2: | 748080-29-7 |
| Pubchem: | 50108 |
| Pubchem2: | 52946590 |
| Drugbank: | DBSALT002720 |
| Drugbank2: | DB09136 |
| Chemspiderid: | 45452 |
| Chemspiderid2: | 4533 |
| Unii: | 39N9K8S2A4 |
| Unii2: | NS6Q291771 |
| Kegg: | D04634 |
| Chembl: | 1200859 |
| Chembl2: | 1615783 |
| Synonyms: | Isosulfan blue inner salt |
| C: | 27 |
| H: | 31 |
| N: | 2 |
| Na: | 1 |
| O: | 6 |
| S: | 2 |
| Smiles: | [Na+].CCN(CC)C1=CC=C(C=C1)C(=C1C=CC(C=C1)=[N+](CC)CC)C1=CC(=CC=C1S([O-])(=O)=O)S([O-])(=O)=O |
| Smiles2: | CCN(CC)c1ccc(cc1)C(=C2C=CC(=[N+](CC)CC)C=C2)c3cc(ccc3S(=O)(=O)[O-])S(=O)(=O)O |
| Stdinchi: | 1S/C27H32N2O6S2.Na/c1-5-28(6-2)22-13-9-20(10-14-22)27(21-11-15-23(16-12-21)29(7-3)8-4)25-19-24(36(30,31)32)17-18-26(25)37(33,34)35;/h9-19H,5-8H2,1-4H3,(H-,30,31,32,33,34,35);/q;+1/p-1 |
| Stdinchi2: | 1S/C27H32N2O6S2/c1-5-28(6-2)22-13-9-20(10-14-22)27(21-11-15-23(16-12-21)29(7-3)8-4)25-19-24(36(30,31)32)17-18-26(25)37(33,34)35/h9-19H,5-8H2,1-4H3,(H-,30,31,32,33,34,35)/p+1 |
| Stdinchikey: | NLUFDZBOHMOBOE-UHFFFAOYSA-M |
| Stdinchikey2: | YFKDCGWIINMRQY-UHFFFAOYSA-N |
Isosulfan blue, sold under the brand name Lymphazurin among others, is a contrast agent medication used to delineate the lymphatic vessels during a lymphography procedure.[2]