| Drug Name: | Fuzuloparib |
| Tradename: | AiRuiYi |
| Synonyms: | Fluzoparib; SHR3162 |
| Cas Number: | 1358715-18-0 |
| Pubchem: | 56649297 |
| Unii: | TWF0ML1CK8 |
| Drugbank: | DB15637 |
| Chembl: | 3930624 |
| Iupac Name: | 4-4-Fluoro-3-[2-(trifluoromethyl)-6,8-dihydro-5''H''-[1,2,4]triazolo[1,5-''a'']pyrazine-7-carbonyl]phenylmethyl]-2H-phthalazin-1-one |
| C: | 22 |
| H: | 16 |
| F: | 4 |
| N: | 6 |
| O: | 2 |
| Smiles: | C1CN2C(=NC(=N2)C(F)(F)F)CN1C(=O)C3=C(C=CC(=C3)CC4=NNC(=O)C5=CC=CC=C54)F |
| Stdinchi: | InChI=1S/C22H16F4N6O2/c23-16-6-5-12(10-17-13-3-1-2-4-14(13)19(33)29-28-17)9-15(16)20(34)31-7-8-32-18(11-31)27-21(30-32)22(24,25)26/h1-6,9H,7-8,10-11H2,(H,29,33) |
| Stdinchikey: | XJGXCBHXFWBOTN-UHFFFAOYSA-N |
Fuzuloparib (trade name AiRuiYi) is a pharmaceutical drug for the treatment of ovarian cancer.[1] It is approved for use in China.[2] It is an inhibitor of the poly (ADP-ribose) polymerase (PARP) enzyme.[3]
It is also being studied for its potential use for the treatment of pancreatic, breast, prostate, and lung cancer.[2]