The borate fluorides or fluoroborates are compounds containing borate or complex borate ions along with fluoride ions that form salts with cations such as metals. They are in the broader category of mixed anion compounds. They are not to be confused with tetrafluoroborates (BF4) or the fluorooxoborates which have fluorine bonded to boron.
formula | name | mw | system | space group | unit cell Å | volume Å3 | density | comment | references | |
---|---|---|---|---|---|---|---|---|---|---|
Be2(BO3)(OH,F) · H2O | Berborite | trigonal | P3 | a = 4.434, c = 5.334 | 90.82 | colourlessUniaxial (-) nω = 1.580 nε = 1.485 Max birefringence δ = 0.095 | [1] | |||
γ‐Be2BO3F | γ‐BBF | 95.83 | trigonal | R32 | a=4.4418 c=19.909 Z=3 | 340.17 | 1.946 | Uniaxial (-) SHG 2.3 × KDP | ||
NH4Be2BO3F2 | ABBF | 132.87 | trigonal | R32 | a=4.4398 c=12.4697 Z=3 | 212.87 | 2.243 | Uniaxial (-) no=1.49389 ne=1.41919 at 636 nm | [2] | |
NaBe2BO3F2 | sodium beryllium borate fluoride (NBBF) | C2 | a=12.643 b=8.729 c=7.591 β=113.6° | 768 | double layers of borate rings sandwiching barium atoms. Between pairs of double layers are sodium ions with fluoride. | [3] | ||||
Mg2(BO3)(F,OH) | Pertsevite-(F) | orthorhombic | Pna21 | a = 20.49, b = 4.571, c = 11.89 Z=16 | 1,113.6 | Density 3.12transparent Biaxial (+) nα = 1.609 nβ = 1.620 nγ = 1.642 2V: 65° Max birefringence: δ = 0.033 | [4] | |||
Mg3(BO3)(F,OH)3 | Fluoborite | hexagonal | a = 8.8, c = 3.1 | 208 | colourlessUniaxial (-) nω = 1.570 nε = 1.534 Max birefringence δ = 0.036 | [5] | ||||
Mg3(OH)[B(OH)<sub>4</sub>]2(SO4)F | sulfoborite | orthorhombic | Pnma | a=10.132 b=12.537 c=7.775 | 987.6 | Biaxial (-) nα = 1.527 nβ = 1.536 nγ = 1.5512V 79° Max birefringence δ = 0.024 | [6] | |||
Na6Mg3B10O18F6 | monoclinic | P21/c | a=13.420 b=6.400 c=10.701 β=90.693° | band gap 5.40 eV; birefringence Δn = 0.039 at 1064 nm | [7] | |||||
NaMgBe2(BO3)2F | NMBBF | Pc1 | a=4.5408 c=13.439 | birefringence 0.081 at 546.1 nm | [8] | |||||
Al6(BO3)5F3 | Jeremejevite | hexagonal | P63/m | a = 8.5591, c = 8.1814 | 519 | density 3.28 Uniaxial (-) nω = 1.653 nε = 1.640 Max birefringence δ = 0.013 | [9] [10] | |||
Al8(BO3)4(B2O5)F8 | 704.7 | tetragonal | P42/mmc | a=9.134 c=19.112 Z=4 | 1,595 | density 2.935 colourless | ||||
Na(Mg3)Al6(Si6O18)(BO3)3(OH)3F | Fluor-dravite | trigonal | R3m | a = 15.955, c = 7.153 Z=3 | 1,577 | density 3.120dark brown Uniaxial (-) nω = 1.645(2) nε = 1.621(2) Max birefringence δ = 0.024 | [11] | |||
Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3F | Fluor-elbaite | trigonal | R3m | a = 15.8933, c = 7.1222 | 1,558 | blue greenUniaxial (-) | [12] | |||
K6B12O19F4 | 744.32 | orthorhombic | Pnma | a =15.291 b =7.707 c =8.672 Z=2 | 1022.0 | 2.419 | [13] | |||
KBe2BO3F2 | KBBF | hexagonal | R32 | a=4.427 c=18.744 | 318.3 | 2.40 | Be2BO6F2 rings SHG 1.2 × KDP; UV cutoff 147 nm | [14] | ||
Ca5(BO3)3F | [15] | |||||||||
Li3CaB2O5F | 363.04 | orthorhombic | Pnma | a=25.685 b=3.4697 c=5.4404 Z=2 | 484.84 | 2.487 | colourless | [16] | ||
Li5Ca9(BO3)7F2 | P1 | |||||||||
NaCaBe2B2O6F | [17] | |||||||||
KCaBe2B2O6F | 467.64 | P3_1c | a=4.705 c=14.554 Z=2 | 279.1 | 2.783 | [18] | ||||
Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3F | Fluor-liddicoatite | trigonal | R3m | a = 15.875, c = 7.126 Z=3 | 1,555 | density 3.02Uniaxial (-) nω = 1.637 nε = 1.621 Max birefringence δ = 0.016 | [19] | |||
CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3F | Fluor-uvite | trigonal | R3m | a = 15.954, c = 7.214 Z=3 | 1,590 | blackUniaxial nω = 1.637 - 1.668 nε = 1.619 - 1.639 Max birefringence δ = 0.018 - 0.029 | [20] | |||
KCaBe2B2O6F | ||||||||||
Sc2F2(B2O5) | 229.54 | orthorhombic | Pbam | a=9.667 b=14.199 c=4.0395 Z=4 | 554.4 | 2.750 | colourless | [21] | ||
K11Sc5(B5O10)4F6 | orthorhombic | Fdd2 | a 56.769 b 12.207 c 12.6088 | transparent to <190 nm | [22] | |||||
Na(Mn2+)3Al6(Si6O18)(BO3)3(OH)3F | Fluor-tsilaisite | trigonal | R3m | a = 15.9398, c = 7.1363 | 1,570 | greenish yellowUniaxial (-) | [23] | |||
NaFe3Al6Si6B3O30F | ||||||||||
Na(Fe2+3)Al6(Si6O18)(BO3)3(OH)3F | Fluor-schorl | trigonal | R3m | a = 16.005, c = 7.176 Z=3 | 1,591.9 | blackUniaxial (-) nω = 1.660 - 1.661 nε = 1.636 - 1.637 Max birefringence δ = 0.024 | [24] | |||
Na(Fe3+3)Al6(Si6O18)(BO3)3O3F | Fluor-buergerite | trigonal | R3m | a = 15.8692, c = 7.1882 | 1,568 | density 3.311brown Uniaxial (-) nω = 1.735 nε = 1.655 Birefringence 0.080 | [25] | |||
Ca(Fe2+)3MgAl5(Si6O18)(BO3)3(OH)3F | Fluor-feruvite | [26] | ||||||||
KCaZn2(BO3)2F | ||||||||||
Li6RbB2O6F | 263.73 | orthorhombic | Pnma | a=8.41 b=15.96 c=5.08 Z=2 | 682 | 2.568 | [27] | |||
RbBe2BO3F2 | RBBF | Trigonal | R32 | a=4.434 c=19.758 z=3 | also contains BeO3F tetrahedra and BO3. It transmits radiation from 180 to 3500 nm. | [28] | ||||
Rb18Mg6(B5O10)3(B7O14)2F | monoclinic | C2/c | a=11.06 b=19.70 c=31.01 β=90.13° | [29] | ||||||
RbCaBe2B2O6F | Trigonal | R32 | [30] | |||||||
KSrBe2B2O6F | ||||||||||
LiSr3Be3B3O9F4 | [31] | |||||||||
NaSr3Be3B3O9F4 | [32] | |||||||||
K3Sr3Li2Al4B6O20F | SHG 4 × KDP; 170 nm UV cutoff | |||||||||
Ca(Y,REE,Ca,Na,Mn)15Fe2+(P,Si)Si6B3O34F14 | Proshchenkoite-(Y) | trigonal | R3m | a = 10.7527, c = 27.4002 | 2,743.6 | brownish | [33] | |||
(Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1−x)(Si,As5+)Si6B3(O,F)48 | Hundholmenite-(Y) | trigonal | R3m | a = 10.675, c = 27.02 Z=3 | 2,667 | density 5.206brownish Uniaxial (-) | [34] | |||
(Na,Ca)3(Y,Ce)12Si6B2O27F14 | Okanoganite-(Y) | trigonal | R3m | a = 10.7108, c = 27.040 | 4.35 | Tan colouredUniaxial (-) nω = 1.753 nε = 1.740 Max birefringence δ = 0.013 | [35] | |||
? Y5(SiO4,BO4)3(O,OH,F) | Tritomite-(Y) | ?hexagonal | a = 9.32, c = 6.84 | 3.05-3.4 | isotropicn = 1.627 - 1.685 | |||||
Cd8B5O15F | 1212.25 | cubic | Fdm | a = 13.972 Z = 8 | 2,727 | 5.904 | colourless | [36] | ||
CdZn2KB2O6F | ||||||||||
Li3Cs6Al2B14O28F | 1490.58 | orthorhombic | Pnma | a=21.8412 b=19.8875 c=7.1577 Z=4 | 3109.1 | 3.184 | [37] | |||
CsBe2BO3F2 | 247.74 | trigonal | R32 | a=4.4575 c=21.310 Z=3 | 366.7 | 3.366 | colourless | [38] | ||
Cs18Mg6(B5O10)3(B7O14)2F | monoclinic | C2/c | a=11.234 b=20.11 c=32.12 β=90.225° | |||||||
CsCaBe2B2O6F | trigonal | R32 | [39] | |||||||
BaBOF3 | 221.15 | monoclinic | P21/c | a = 4.620 b = 15.186 c = 4.426 β = 92.045° Z=4 | 310.3 | contains chains of -OB(F2)- and a double chain of BaF | [40] | |||
Ba5(BO3)3F | [41] | |||||||||
Li2BaSc(BO3)2F | 332.80 | hexagonal | P63/m | a=4.895 c=14.346 | 297.7 | 3.713 | [42] | |||
LiBa12(BO3)7F4 | I4/mcm | |||||||||
BaBe2BO3F3 | 271.16 | hexagonal | P63 | a=7.628 c=13.990 Z=6 | 704.9 | 3.832 | UV cutoff <185 nm; birefringence 0,081 at 200 nm | [43] | ||
NaBa12(BO3)7F4 | I4/mcm | |||||||||
BaMgBe2(BO3)2F2 | BMBBF | 335.283 | trigonal | Pc1 | a=4.5898 c=15.348 | 280.01 | 3.976 | colourless [Be<sub>2</sub>B<sub>3</sub>O<sub>6</sub>F<sub>2</sub>]∞ | [44] | |
Ba3.75MgB7O14F2.5 | 886.50 | monoclinic | C2/c | a 16.611 b 13.677 c 15.141 β 121.239° Z=8 | 2941.0 | 4.004 | transparent > 203 nm; birefringence 0.081@546 nm | [45] | ||
BaAl(BO3)F2 | hexagonal | P | a=4.8879 c=9.403 Z=2 | 194.5 | UV cutoff 165 nm | [46] | ||||
K3Ba3Li2Al4B6O20F | ||||||||||
K5Ba10(BO3)8F | trigonal | Rc | a = 15.293, c = 22.699 Z = 6 | [47] | ||||||
KBa7Mg2B14O28F5 | monoclinic | C2/c | a = 16.638 b = 13.609 c = 15.214 β = 121.309° Z=4 | 2943.3 | 3.934 | colourless | [48] | |||
BaCaBe2(BO3)2F2 | BCBBF | trigonal | Pc1 | a=4.6931 c=16.049 | 306.12 | 3.808 | colourless [Be<sub>2</sub>B<sub>3</sub>O<sub>6</sub>F<sub>2</sub>]∞ | |||
Li2BaSc(BO3)2F | hexagonal | P63/m | a=4.895 c=14.346 | [49] | ||||||
Ba3Zn(BO3)(B2O5)F | 656.82 | monoclinic | P21/c | a = 15.179 b = 7.0064 c = 8.763 β = 100.15° Z=4 | 917.4 | 4.755 | colourless | [50] | ||
Ba4Zn2(BO3)2(B2O5)F2 | 937.34 | monoclinic | C2/c | a=20.39 b=4.998 c=13.068 β = 192.59 Z=44 | 1,331 | 4.679 | colourless | |||
BaZnBe2(BO3)2F2 | 376.35 | trigonal | P | a = 4.5998, c = 7.7037 Z = 1 | 141.16 | 4.427 | colourless | [51] | ||
Rb3Ba3Li2Al4B6O20F | ||||||||||
BaCdBe2(BO3)2F2 | BDBBF | Pc1 | a=4.6808 c=15.788 | |||||||
Ba1.09Pb0.91Be2(BO3)2F2 | BPBBF | trigonal | Pm1 | a = 4.7478 c = 8.386, Z = 1 | 163.70 | UV absorption edge=279.1 nm; birefringence 0.054 at 546.1 nm; 2D [Be<sub>3</sub>B<sub>3</sub>O<sub>6</sub>F<sub>3</sub>]∞ layer | [52] | |||
LiBa2Pb(BO3)2F | orthorhombic | Pmmn | a=5.487 b=15.96 c=4.034 | |||||||
KNa3Na6Ca2Ba6Mn6(Ti4+,Nb)6B12Si36O114(O,OH,F)11 | Tienshanite | hexagonal | P6/m | a = 16.785, c = 10.454 Z=1 | 2,551 | pale olive greenUniaxial (-) nω = 1.666 nε = 1.653 Max birefringence δ = 0.013 | [53] | |||
Ca6(Fe2+,Mn2+)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 | Laptevite-(Ce) | trigonal | R3m | a = 10.804, c = 27.726 Z=3 | 2,803 | density 4.61dark brown Uniaxial (-) nω = 1.741(3) nε = 1.720(3) Max birefringence δ = 0.021 | [54] | |||
Ba(Y,Ce)6Si3B6O24F2 | Cappelenite-(Y) | trigonal | P3 | a = 10.67, c = 4.68 Z=1 | 461 | 4.407 | greenish brown | [55] | ||
CaMg[(Ce<sub>7</sub>Y<sub>3</sub>)Ca<sub>5</sub>](SiO4)4(Si2B3AsO18)(BO3)F11 | Arrheniusite-(Ce) | trigonal | R3m | a = 10.8082, c = 27.5196 | [56] | |||||
Gd4(BO2)O5F | orthorhombic | Pmmn | a=15.746 b=3.8142 c=6.609 Z=2 | 396.9 | 6.45 | colourless | [57] | |||
Gd2(BO3)F3 | ||||||||||
Gd3(BO3)2F3 | ||||||||||
Gd4[B<sub>4</sub>O<sub>11</sub>]F2 | ||||||||||
Ba2Gd(BO3)2F | orthorhombic | Pnma | a = 7.571 b = 10.424 c = 8.581 Z = 2 | [58] | ||||||
Eu5(BO3)3F | orthorhombic | Pnma | a=7.225 b=14.124 c=9.859 Z=4 | 1006.1 | 6.306 | yellow | [59] | |||
TlBe2BO3F2 | Trigonal | R32 | a=4.4387 c=19.942 Z=3 | 340.27 | 4.673 | colourless | [60] | |||
LiBa2Pb(BO3)2F | orthorhombic | Pmmn | a=5.487 b=15.97 c=4.034 | 353.4 | 5.887 | colourless | [61] | |||
(Ca,Ce,La,Th)15As5+(As3+0.5,Na0.5)Fe3+Si6B4O40F7 | Vicanite-(Ce) | trigonal | R3m | a=10.881 c=27.33 | 2,766 | 4.82 | greenish yellowUniaxial (-) nω = 1.757 nε = 1.722 Max birefringence δ = 0.035 | [62] |