| Verifiedfields: | changed |
| Watchedfields: | changed |
| Verifiedrevid: | 447984130 |
| Iupac Name: | 2-[4-(4-chlorophenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid |
| Tradename: | Norvedan |
| Cas Number: | 18046-21-4 |
| Atc Prefix: | M02 |
| Atc Suffix: | AA14 |
| Pubchem: | 28871 |
| Unii: | 0YHF6E6NLS |
| Kegg: | D01975 |
| Chemspiderid: | 26854 |
| Chembl: | 589092 |
| C: | 17 |
| H: | 12 |
| Cl: | 1 |
| N: | 1 |
| O: | 2 |
| S: | 1 |
| Smiles: | c1ccc(cc1)c2nc(c(s2)CC(=O)O)c3ccc(cc3)Cl |
| Stdinchi: | 1S/C17H12ClNO2S/c18-13-8-6-11(7-9-13)16-14(10-15(20)21)22-17(19-16)12-4-2-1-3-5-12/h1-9H,10H2,(H,20,21) |
| Stdinchikey: | JIEKMACRVQTPRC-UHFFFAOYSA-N |
| Melting Point: | 162-163 |
Fentiazac is a thiazole-based nonsteroidal anti-inflammatory drug (NSAID) developed for use in joint and muscular pain.[1] Like most other NSAIDs, it acts through inhibition of prostaglandin synthesis, via non-selective inhibition of both COX-1 and COX-2. First described in 1974, it was synthesized using the Hantzsch thiazole synthesis.[2]
Fentiazac was marketed under the trade-name Norvedan (among others), but its market status is currently unknown and assumed to be discontinued.[3]