| Cas Number: | 85750-39-6 |
| Pubchem: | 157211 |
| Chemspiderid: | 138362 |
| Unii: | 3RLD929C4S |
| Chebi: | 134737 |
| Chembl: | 2105571 |
| Synonyms: | Etilephrine pivalate; Ethylnorphenylephrine pivalate; Pivalyletilefrine; 3,β-Dihydroxy-N-ethylphenethylamine 3-pivalate |
| Iupac Name: | [3-[2-(ethylamino)-1-hydroxyethyl]phenyl] 2,2-dimethylpropanoate |
| C: | 15 |
| H: | 23 |
| N: | 1 |
| O: | 3 |
| Smiles: | CCNCC(C1=CC(=CC=C1)OC(=O)C(C)(C)C)O |
| Stdinchi: | 1S/C15H23NO3/c1-5-16-10-13(17)11-7-6-8-12(9-11)19-14(18)15(2,3)4/h6-9,13,16-17H,5,10H2,1-4H3 |
| Stdinchikey: | DRMHNJGOEAYOIZ-UHFFFAOYSA-N |
Etilefrine pivalate ; developmental code name K-30052) is a sympathomimetic agent which was never marketed.[1] [2] It is the 3-pivalate ester of etilefrine (ethylnorphenylephrine) and has much greater lipophilicity than etilefrine.[3] Some related compounds include pivenfrine (phenylephrine pivalate) and dipivefrine (epinephrine dipivalate), which were developed as mydriatic agents.