| Drug Name: | Enarodustat |
| Synonyms: | JTZ-951 |
| Tradename: | Enaroy |
| Legal Status: | Rx-only (Japan) |
| Cas Number: | 1262132-81-9 |
| Chemspiderid: | 64835234 |
| Pubchem: | 50899324 |
| Unii: | JSK7TUA223 |
| Drugbank: | 14985 |
| Kegg: | D11523 |
| Chembl: | 4297619 |
| Iupac Name: | 2-acetic acid |
| C: | 17 |
| H: | 16 |
| N: | 4 |
| O: | 4 |
| Stdinchi: | 1S/C17H16N4O4/c22-13-8-12(7-6-11-4-2-1-3-5-11)21-16(19-10-20-21)15(13)17(25)18-9-14(23)24/h1-5,8,10H,6-7,9H2,(H,18,25)(H,19,20)(H,23,24) |
| Stdinchikey: | FJYRBJKWDXVHHO-UHFFFAOYSA-N |
| Smiles: | C1=CC=C(C=C1)CCC2=CC(=O)C(=C3N2NC=N3)C(=O)NCC(=O)O |
Enarodustat (development code JTZ-951; brand name Enaroy) is a drug used for the treatment of anemia, especially when associated with chronic kidney disease (CKD). Enarodustat functions as a inhibitor of hypoxia inducible factor-proly hydroxylase (HIF-PH).[1]
The drug was approved in September 2020 in Japan for anemia associated with CKD[2] and is currently in clinical development in the United States and South Korea.[3] The drug is being developed by Japan Tobacco and JW Pharmaceutical.[4]