Iupac Name: | (14S,27R)-22,33-dimethoxy-13,28-dimethyl-2,5,7,20-tetraoxa-13,28-diazaoctacyclo[25.6.2.2<sup>16,19</sup>.1<sup>3,10</sup>.1<sup>21,25</sup>.0<sup>4,8</sup>.0<sup>31,35</sup>.0<sup>14,39</sup>]nonatriaconta-1(33),3(39),4(8),9,16(38),17,19(37),21,23,25(36),31,34-dodecaene |
Cas Number: | 481-49-2 |
Unii: | 7592YJ0J6T |
Atc Prefix: | none |
Pubchem: | 10206 |
Chembl: | 449782 |
Chemspiderid: | 9791 |
Synonyms: | Cepharantin, O-Methylcepharanoline |
C: | 37 |
H: | 38 |
N: | 2 |
O: | 6 |
Smiles: | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)C[C@@H]7C8=CC(=C(C=C8CCN7C)OC)O4)OC)OCO3 |
Stdinchi: | 1S/C37H38N2O6/c1-38-13-11-24-18-31(41-4)33-20-27(24)28(38)16-23-7-10-30(40-3)32(17-23)44-26-8-5-22(6-9-26)15-29-35-25(12-14-39(29)2)19-34-36(37(35)45-33)43-21-42-34/h5-10,17-20,28-29H,11-16,21H2,1-4H3/t28-,29+/m1/s1 |
Stdinchikey: | YVPXVXANRNDGTA-WDYNHAJCSA-N |
Cepharanthine is an antiinflammatory and antineoplastic compound isolated from Stephania.[1] Due to these modalities, it has been shown effective against HTLV in lab research. [2] Additionally, it has successfully been used to treat a diverse range of medical conditions, including radiation-induced leukopenia, idiopathic thrombocytopenic purpura, alopecia areata, alopecia pityrodes, venomous snakebites, xerostomia, sarcoidosis, refractory anemia and various cancer-related conditions. No safety issues have been observed with CEP, and side effects are very rarely reported. [3]