| Inn: | Butirosin |
| Cas Number: | 12772-35-9 |
| Class: | Aminoglycoside antibiotic |
| Pubchem: | 72393 |
| Chemspiderid: | 65326 |
| Chebi: | 65109 |
| Kegg: | C01559 |
| Unii: | 8S52KR0L58 |
| Smiles: | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC(=O)[C@@H](CCN)O)O)O[C@@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)N)N |
| Stdinchi: | 1S/C21H41N5O12/c22-2-1-8(28)19(34)26-7-3-6(24)17(37-20-11(25)15(32)13(30)9(4-23)35-20)18(12(7)29)38-21-16(33)14(31)10(5-27)36-21/h6-18,20-21,27-33H,1-5,22-25H2,(H,26,34)/t6-,7+,8+,9+,10+,11+,12-,13+,14+,15+,16+,17+,18+,20+,21+/m0/s1 |
| Stdinchikey: | XEQLFNPSYWZPOW-NUOYRARPSA-N |
| Synonyms: | Ambutyrosin; Butyrosin |
Butirosin is an aminoglycoside antibiotic complex which is active against both Gram-positive and Gram-negative bacteria.[1] It is a mixture with butirosin A (80-85%) and butirosin B being the major components.[2]