| Cas Number: | 3748-77-4 |
| Pubchem: | 13986 |
| Chemspiderid: | 11644438 |
| Unii: | A9IW1G3P6C |
| Drugbank: | DB11501 |
| Chembl: | 1355596 |
| Iupac Name: | N,N-Dibutyl-4-hexoxynaphthalene-1-carboximidamide |
| C: | 25 |
| H: | 38 |
| N: | 2 |
| O: | 1 |
| Stdinchi: | 1S/C25H38N2O/c1-4-7-10-13-20-28-24-17-16-23(21-14-11-12-15-22(21)24)25(26)27(18-8-5-2)19-9-6-3/h11-12,14-17,26H,4-10,13,18-20H2,1-3H3 |
| Stdinchikey: | FGGFIMIICGZCCJ-UHFFFAOYSA-N |
| Smiles: | CCCCCCOC1=CC=C(C2=CC=CC=C21)C(=N)N(CCCC)CCCC |
Bunamidine is an anthelmintic drug used in veterinary medicine to treat infections by tapeworm parasites of the genus Taenia;[1] thus it is classified as a taeniacide.
It is also effective against Echinococcus granulosus (dog tapeworm)[2] and Hymenolepis diminuta (rat tapeworm).[3]