| Cas Number: | 1802148-05-5 |
| Pubchem: | 118253852 |
| Iuphar Ligand: | 9412 |
| Drugbank: | DB15638 |
| Chemspiderid: | 67896269 |
| Unii: | 25CG88L0BB |
| Kegg: | D12120 |
| Chembl: | 3900409 |
| Synonyms: | AZD7986; INS1007 |
| Iupac Name: | (2S)-N-[(1S)-1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]-1,4-oxazepane-2-carboxamide |
| C: | 23 |
| H: | 24 |
| N: | 4 |
| O: | 4 |
| Smiles: | CN1C2=C(C=CC(=C2)C3=CC=C(C=C3)C[C@@H](C#N)NC(=O)[C@@H]4CNCCCO4)OC1=O |
| Stdinchi: | 1S/C23H24N4O4/c1-27-19-12-17(7-8-20(19)31-23(27)29)16-5-3-15(4-6-16)11-18(13-24)26-22(28)21-14-25-9-2-10-30-21/h3-8,12,18,21,25H,2,9-11,14H2,1H3,(H,26,28)/t18-,21-/m0/s1 |
| Stdinchikey: | AEXFXNFMSAAELR-RXVVDRJESA-N |
Brensocatib is an investigational new drug that is being evaluated to treat bronchiectasis.[1] It is a dipeptidyl-peptidase I (also known as cathepsin C) inhibitor.[2]