| Iupac Name: | (1S,2R,3S,4R,6R,7R,8R,14R)-4-Ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxotricyclo[5.4.3.0<sup>1,8</sup>]tetradec-6-yl [(5-amino-1''H''-1,2,4-triazol-3-yl)sulfanyl]acetate |
| Cas Number: | 76530-44-4 |
| Atc Prefix: | None |
| Pubchem: | 16072188 |
| Chemspiderid: | 17231671 |
| Unii: | 875AQ866X1 |
| Chembl: | 2103760 |
| C: | 24 |
| H: | 38 |
| N: | 4 |
| O: | 4 |
| S: | 1 |
| Smiles: | CC[C@@]1(C[C@H]([C@@]2([C@@H](CC[C@@]3([C@H]2C(=O)CC3)[C@H]([C@@H]1O)C)C)C)OC(=O)CSc4nc([nH]n4)N)C |
| Stdinchi: | 1S/C24H38N4O4S/c1-6-22(4)11-16(32-17(30)12-33-21-26-20(25)27-28-21)23(5)13(2)7-9-24(14(3)19(22)31)10-8-15(29)18(23)24/h13-14,16,18-19,31H,6-12H2,1-5H3,(H3,25,26,27,28)/t13-,14+,16-,18+,19+,22-,23+,24+/m1/s1 |
| Stdinchikey: | FMHQJXGMLMSMLC-WBUYAQKGSA-N |
Azamulin is a pleuromutilin antibiotic., it is not marketed in the US or Europe.
In pharmacological studies, the substance is used as an inhibitor of the liver enzymes CYP3A4 and CYP3A5.