| Verifiedrevid: | 399498190 |
| Iupac Name: | [1-(5-methoxy-1''H''-indol-3-yl)propan-2-yl](methyl)amine |
| Cas Number: | 4822-13-3 |
| Unii: | PJ8WT93MNQ |
| Pubchem: | 20961 |
| Chemspiderid: | 19718 |
| C: | 13 |
| H: | 18 |
| N: | 2 |
| O: | 1 |
| Smiles: | O(c1cc2c(cc1)[nH]cc2CC(NC)C)C |
| Stdinchi: | 1S/C13H18N2O/c1-9(14-2)6-10-8-15-13-5-4-11(16-3)7-12(10)13/h4-5,7-9,14-15H,6H2,1-3H3 |
| Stdinchikey: | IYEMYZOLBLHKFE-UHFFFAOYSA-N |
Alpha,N,O-TMS, or α,N-dimethyl-5-methoxytryptamine, is a lesser-known psychedelic drug. Its abbreviated nomenclature is derived from its structure, as it is α,N,O-trimethyl serotonin. α,N,O-TMS was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), Shulgin lists the dosage as 10-20 mg when taken orally, and the duration as 6–8 hours.[1]