Drug Name: | Zimlovisertib |
C: | 18 |
H: | 20 |
F: | 1 |
N: | 3 |
O: | 4 |
Iupac Name: | 1-(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-ylmethoxy]-7-methoxyisoquinoline-6-carboxamide| CAS_number = 1817626-54-2| CAS_supplemental = | DrugBank = DB15143| ChemSpiderID = 58805665| PubChem = 118414016| UNII = S3F315JJXI| ChEMBL = 4081711| smiles = CC[C@H]1[C@H](NC(=O)[C@H]1F)COC2=NC=CC3=CC(=C(C=C32)OC)C(=O)N| StdInChI = 1S/C18H20FN3O4/c1-3-10-13(22-17(24)15(10)19)8-26-18-11-7-14(25-2)12(16(20)23)6-9(11)4-5-21-18/h4-7,10,13,15H,3,8H2,1-2H3,(H2,20,23)(H,22,24)/t10-,13+,15-/m0/s1| StdInChIKey = JKDGKIBAOAFRPJ-ZBINZKHDSA-N}}Zimlovisertib (PF-06650833) is a drug which acts as a selective inhibitor of the enzyme Interleukin-1 receptor-associated kinase 4 (IRAK-4). It has antiinflammatory effects and has been trialed for various indications including hidradenitis suppurativa and treatment of COVID-19 infection, and while it has not been adopted into clinical use it continues to be used for research in this area.[1] [2] [3] See alsoReferences] |