| Routes Of Administration: | Intravenous administration |
| Class: | Dopamine D1-like receptor agonists |
| Cas Number: | 139233-53-7 |
| Cas Supplemental: | 138086-00-7 (hydrochloride) |
| Pubchem: | 3078105 |
| Chemspiderid: | 2336394 |
| Unii: | IR6XYD8SAX |
| Chembl: | 2105532 |
| Synonyms: | Selandopam; (–)-(S)-7,8-Dihydroxy-4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline; 7,8-DDPTI; YM-435; YM435; MYD-37; MYD37 |
| Iupac Name: | (4S)-4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinoline-7,8-diol |
| C: | 15 |
| H: | 15 |
| N: | 1 |
| O: | 4 |
| Smiles: | C1[C@H](C2=C(CN1)C(=C(C=C2)O)O)C3=CC(=C(C=C3)O)O |
| Stdinchi: | 1S/C15H15NO4/c17-12-3-1-8(5-14(12)19)10-6-16-7-11-9(10)2-4-13(18)15(11)20/h1-5,10,16-20H,6-7H2/t10-/m0/s1 |
| Stdinchikey: | FULLEMQICAKPOE-JTQLQIEISA-N |
Zelandopam (; developmental code names YM-435, MYD-37) is a selective dopamine D1-like receptor agonist related to fenoldopam which was under development in Japan for the treatment of hypertension and heart failure but was never marketed.[1] [2] [3] The drug was being developed for use by intravenous administration. The development of zelandopam appears to have been discontinued by the early 2000s. It was first described in the scientific literature by 1991.[4]