| Legal Status: | Investigational |
| Cas Number: | 1034190-08-3 |
| Pubchem: | 25008296 |
| Drugbank: | DB19191 |
| Chemspiderid: | 27819042 |
| Unii: | GHG2B47067 |
| Kegg: | D12218 |
| Chembl: | 4650301 |
| Synonyms: | ALZ-801; BLU8499 |
| Iupac Name: | 3-(2S)-2-amino-3-methylbutanoylamino]propane-1-sulfonic acid| C=8 | H=18 | N=2 | O=4 | S=1| SMILES = CC(C)[C@@H](C(=O)NCCCS(=O)(=O)O)N| StdInChI = 1S/C8H18N2O4S/c1-6(2)7(9)8(11)10-4-3-5-15(12,13)14/h6-7H,3-5,9H2,1-2H3,(H,10,11)(H,12,13,14)/t7-/m0/s1| StdInChIKey = NRZRFNYKMSAZBI-ZETCQYMHSA-N}}Valiltramiprosate is an investigational new drug that is being evaluated to treat early Alzheimer's disease.[1] It is an amyloid precursor protein antagonist.[2] References} |