| Verifiedfields: | changed |
| Verifiedrevid: | 470616274 |
| Iupac Name: | 2,2-bis(ethylsulfonyl)butane |
| Width: | 180 |
| Width2: | 180 |
| Legal Us: | Schedule III |
| Cas Number: | 76-20-0 |
| Atc Prefix: | none |
| Chemspiderid: | 6193 |
| Stdinchi: | 1S/C8H18O4S2/c1-5-8(4,13(9,10)6-2)14(11,12)7-3/h5-7H2,1-4H3 |
| Stdinchikey: | LKACJLUUJRMGFK-UHFFFAOYSA-N |
| Pubchem: | 6433 |
| Unii: | 217727W28W |
| C: | 8 |
| H: | 18 |
| O: | 4 |
| S: | 2 |
| Smiles: | CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC |
Trional (Methylsulfonal) is a sedative-hypnotic[1] and anesthetic drug with GABAergic actions. It has similar effects to sulfonal, except it is faster acting.[2]
Trional was prepared and introduced by Eugen Baumann and Alfred Kast in 1888.[3]
Appeared in Agatha Christie's Murder on the Orient Express, And Then There Were None, and other novels such as John Bude's The Lake District Murder as a sleep-inducing sedative; and in In Search of Lost Time (Sodom and Gomorrah) by Marcel Proust as a hypnotic. Sax Rohmer also references trional in his novel Dope.