| Width: | 150px |
| Cas Number: | 6503-95-3 |
| Cas Supplemental: | 7082-30-6 (sulfate) |
| Pubchem: | 23484 |
| Chemspiderid: | 21956 |
| Unii: | OPV4883241 |
| Chembl: | 2111165 |
| Synonyms: | (Dimethylamino)trimethylpyrazine; W-3976B; W3976-B; W-3976-B; W3976B; 3,5,6-Trimethylampyzine |
| Iupac Name: | N,N,3,5,6-pentamethylpyrazin-2-amine |
| C: | 9 |
| H: | 15 |
| N: | 3 |
| Smiles: | CC1=C(N=C(C(=N1)C)N(C)C)C |
| Stdinchi: | 1S/C9H15N3/c1-6-7(2)11-9(12(4)5)8(3)10-6/h1-5H3 |
| Stdinchikey: | RKPVUWPGCFGDJO-UHFFFAOYSA-N |
Triampyzine, also known as triampyzine sulfate (; developmental code name W-3976B) in the case of the sulfate salt, as (dimethylamino)trimethylpyrazine, or as 3,5,6-trimethylampyzine, is a drug described as an anticholinergic and antisecretory agent which was never marketed.[1] [2] [3] [4] [5] It was first described in the literature by 1966.[6] The drug is the 3,5,6-trimethylated derivative of ampyzine (W-3580B), which is also a drug and is, conversely, described as a "central stimulant".