| Iupac Name: | 5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide| C=22 | H=26 | N=6 | O=2| molecular_weight = | SMILES = CCC1=CC2=C(C=C(C=N2)CN3CCN(CC3)C4=CN=C(C=C4)C(=O)NC)NC1=O| Jmol = | StdInChI = InChI=1S/C22H26N6O2/c1-3-16-11-19-20(26-21(16)29)10-15(12-24-19)14-27-6-8-28(9-7-27)17-4-5-18(25-13-17)22(30)23-2/h4-5,10-13H,3,6-9,14H2,1-2H3,(H,23,30)(H,26,29)| StdInChI_comment = | StdInChIKey = WQAVGRAETZEADU-UHFFFAOYSA-N| density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}Saruparib is a investigational new drug that is being evaluated for the treatment of cancer.[1] It first-in-class selective inhibitor of poly-ADP ribose polymerase 1 (PARP1), designed to treat cancers with homologous recombination repair (HRR) deficiencies as a result of mutations in BRCA1, BRCA2, PALB2, RAD51C, or RAD51D genes.[2] References
|
