| Tradename: | Xegafri |
| Routes Of Administration: | By mouth |
| Atc Prefix: | L01 |
| Atc Suffix: | EB05 |
| Cas Number: | 1374640-70-6 |
| Pubchem: | 57335384 |
| Drugbank: | DB11907 |
| Chemspiderid: | 30646712 |
| Unii: | 72AH61702G |
| Kegg: | D10858 |
| Synonyms: | CO-1686, AVL-301 |
| Iupac Name: | N-(3- |
| C: | 27 |
| H: | 28 |
| F: | 3 |
| N: | 7 |
| O: | 3 |
| Smiles: | CC(=O)N1CCN(CC1)c2ccc(c(c2)OC)Nc3ncc(c(n3)Nc4cccc(c4)NC(=O)C=C)C(F)(F)F |
| Stdinchi: | 1S/C27H28F3N7O3/c1-4-24(39)32-18-6-5-7-19(14-18)33-25-21(27(28,29)30)16-31-26(35-25)34-22-9-8-20(15-23(22)40-3)37-12-10-36(11-13-37)17(2)38/h4-9,14-16H,1,10-13H2,2-3H3,(H,32,39)(H2,31,33,34,35) |
| Stdinchikey: | HUFOZJXAKZVRNJ-UHFFFAOYSA-N |
Rociletinib is a medication developed to treat non-small cell lung carcinomas with a specific mutation. It is a third-generation epidermal growth factor receptor tyrosine kinase inhibitor.[1] It was being developed by Clovis Oncology as a potential treatment for non-small-cell lung cancer.[1] In May 2016, development of rociletinib was halted, along with its associated clinical trials, and Clovis Oncology withdrew its marketing authorisation application from the European Medicines Agency.[1]