Iupac Name: | [(2''S'',5''R'')-7-Oxo-2-(piperidin-4-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
Legal Us: | Rx-only |
Cas Number: | 1174018-99-5 |
Chemspiderid: | 31137585 |
Pubchem: | 44129647 |
Unii: | 1OQF7TT3PF |
Drugbank: | DB12377 |
Synonyms: | MK-7655 |
C: | 12 |
H: | 20 |
N: | 4 |
O: | 6 |
S: | 1 |
Smiles: | C1C[C@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)O)C(=O)NC3CCNCC3 |
Stdinchi: | 1S/C12H20N4O6S/c17-11(14-8-3-5-13-6-4-8)10-2-1-9-7-15(10)12(18)16(9)22-23(19,20)21/h8-10,13H,1-7H2,(H,14,17)(H,19,20,21)/t9-,10+/m1/s1 |
Stdinchikey: | SMOBCLHAZXOKDQ-ZJUUUORDSA-N |
Relebactam is a chemical compound used in combination with antibiotics to improve their efficacy. As a beta-lactamase inhibitor,[1] it blocks the ability of bacteria to break down a beta-lactam antibiotic. In the United States, relebactam is approved for use in the combination imipenem/cilastatin/relebactam (Recarbrio).[2]