Legal Status: | Investigational |
Cas Number: | 1345410-31-2 |
Pubchem: | 67454400 |
Iuphar Ligand: | 11801 |
Drugbank: | DB15256 |
Chemspiderid: | 75531291 |
Unii: | 4S0HBYW6QE |
Kegg: | D11363 |
Chembl: | 4297600 |
Synonyms: | CK-2127107 |
Iupac Name: | 1-[2-[[3-fluoro-1-(3-fluoropyridin-2-yl)cyclobutyl]methylamino]pyrimidin-5-yl]pyrrole-3-carboxamide| C=19 | H=18 | F=2 | N=6 | O=1| SMILES = C1C(CC1(CNC2=NC=C(C=N2)N3C=CC(=C3)C(=O)N)C4=C(C=CC=N4)F)F| StdInChI = 1S/C19H18F2N6O/c20-13-6-19(7-13,16-15(21)2-1-4-23-16)11-26-18-24-8-14(9-25-18)27-5-3-12(10-27)17(22)28/h1-5,8-10,13H,6-7,11H2,(H2,22,28)(H,24,25,26)| StdInChIKey = MQXWPWOCXGARRK-UHFFFAOYSA-N}}Reldesemtiv is an investigational new drug that is being evaluated to treat amyotrophic lateral sclerosis.[1] It is a troponin activator.[2] References} |