| Iupac Name: | 4-amino-5-fluoro-1-[(2''S'',5''R'')-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1,2-dihydropyrimidin-2-one |
| Routes Of Administration: | Investigational |
| Cas Number: | 137530-41-7 |
| Unii: | 9PDN1V466A |
| Atc Prefix: | none |
| Pubchem: | 454858 |
| Niaid Chemdb: | 005245 |
| Chemspiderid: | 400521 |
| C: | 8 |
| H: | 10 |
| F: | 1 |
| N: | 3 |
| O: | 3 |
| S: | 1 |
| Smiles: | c1c(c(nc(=O)n1[C@H]2CS[C@H](O2)CO)N)F |
| Stdinchi: | 1S/C8H10FN3O3S/c9-4-1-12(8(14)11-7(4)10)5-3-16-6(2-13)15-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6+/m1/s1 |
| Stdinchikey: | XQSPYNMVSIKCOC-RITPCOANSA-N |
Racivir is an experimental nucleoside reverse transcriptase inhibitor (NRTI), developed by Pharmasset for the treatment of HIV.[1] It is the enantiomer of emtricitabine, a widely used NRTI, meaning that the two compounds are mirror images of each other.