| Drug Name: | Orelabrutinib |
| Tradename: | 宜诺凯 |
| Atc Prefix: | L01 |
| Atc Suffix: | EL04 |
| Legal Status: | Rx-only |
| Synonyms: | ICP-022; ICP022 |
| Cas Number: | 1655504-04-3 |
| Pubchem: | 91667513 |
| Chemspiderid: | 82956396 |
| Iuphar Ligand: | 10629 |
| Unii: | WJA5UO9E10 |
| Chembl: | 4650321 |
| Drugbank: | DB16272 |
| Iupac Name: | 2-(4-Phenoxyphenyl)-6-(1-prop-2-enoylpiperidin-4-yl)pyridine-3-carboxamide |
| C: | 26 |
| H: | 25 |
| N: | 3 |
| O: | 3 |
| Stdinchi: | 1S/C26H25N3O3/c1-2-24(30)29-16-14-18(15-17-29)23-13-12-22(26(27)31)25(28-23)19-8-10-21(11-9-19)32-20-6-4-3-5-7-20/h2-13,18H,1,14-17H2,(H2,27,31) |
| Stdinchikey: | MZPVEMOYADUARK-UHFFFAOYSA-N |
| Smiles: | C=CC(=O)N1CCC(CC1)C2=NC(=C(C=C2)C(=O)N)C3=CC=C(C=C3)OC4=CC=CC=C4 |
Orelabrutinib is a drug for the treatment of cancer.
In China, it is approved for patients with mantle cell lymphoma (MCL) and chronic lymphocytic leukemia/small lymphocytic lymphoma (CLL/SLL), who have received at least one treatment in the past.[1]
Orelabrutinib is an inhibitor of Bruton's tyrosine kinase.[2]