Legal Status: | Investigational |
Cas Number: | 1628732-62-6 |
Pubchem: | 90445883 |
Chemspiderid: | 64835205 |
Drugbank: | DB15238 |
Iuphar Ligand: | 10213 |
Synonyms: | IW-1701 |
Chembl: | 4297616 |
Kegg: | D11475 |
Unii: | PD5F4ZXD21 |
Stdinchi: | 1S/C21H16F5N7O3/c22-12-4-2-1-3-11(12)9-33-16(14-5-6-36-32-14)7-15(31-33)18-28-8-13(23)17(30-18)29-10-20(35,19(27)34)21(24,25)26/h1-8,35H,9-10H2,(H2,27,34)(H,28,29,30)/t20-/m1/s1 |
Stdinchikey: | YWQFJNWMWZMXRW-HXUWFJFHSA-N |
Smiles: | C1=CC=C(C(=C1)CN2C(=CC(=N2)C3=NC=C(C(=N3)NC[C@@](C(=O)N)(C(F)(F)F)O)F)C4=NOC=C4)F |
Iupac Name: | (2R)-3,3,3-Trifluoro-2-5-fluoro-2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-ylamino]methyl]-2-hydroxypropanamide| C = 21 | H = 16 | F = 5 | N = 7 | O = 3}} Olinciguat (IW-1701) is a soluble guanylate cyclase stimulator that was in development for sickle cell anemia.[1] [2] [3] After receiving orphan drug status in 2018[4] and completing a phase II trial, its development for sickle cell anemia was discontinued in 2020.[5] References |