| Iupac Name: | N-(3-Fluoro-4- |
| Width: | 300 |
| Routes Of Administration: | PO |
| Cas Number: | 1206799-15-6 |
| Unii: | 5OGS5K699E |
| Atc Prefix: | none |
| Kegg: | D11763 |
| Chemspiderid: | 29361338 |
| C: | 30 |
| H: | 22 |
| F: | 2 |
| N: | 6 |
| O: | 3 |
| Smiles: | Cc1ccc(c(=O)n1c2ccc(cc2)F)C(=O)Nc3ccc(c(c3)F)Oc4cc5cnn(c5cc4c6c[nH]nc6)C |
| Stdinchi: | 1S/C30H22F2N6O3/c1-17-3-9-23(30(40)38(17)22-7-4-20(31)5-8-22)29(39)36-21-6-10-27(25(32)12-21)41-28-11-18-16-35-37(2)26(18)13-24(28)19-14-33-34-15-19/h3-16H,1-2H3,(H,33,34)(H,36,39) |
| Stdinchikey: | QHADVLVFMKEIIP-UHFFFAOYSA-N |
Merestinib (LY2801653) is an experimental cancer drug in development by Eli Lilly. It is a small molecule inhibitor of MET and several other receptor tyrosine kinases such as MST1R, FLT3, AXL, MERTK, TEK, ROS1, NTRK1/2/3, and DDR1/2.[1]
Meristinib is part of a phase II clinical trial for advanced billiary tract cancer. The study is expected to be complete in April 2018. Phase II clinical trials for non-small cell lung cancer and solid tumors began in November 2016.[2]