| Iupac Name: | 2-[2-[2-[(''E'')-2-[4-(Trifluoromethyl)phenyl]ethenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
| Cas Number: | 956274-94-5 |
| Pubchem: | 17751090 |
| Chemspiderid: | 29271895 |
| Drugbank: | DB12875 |
| Unii: | F197218T99 |
| Chembl: | 2364618 |
| Synonyms: | JNJ-39439335 |
| C: | 25 |
| H: | 21 |
| F: | 3 |
| N: | 2 |
| O: | 1 |
| Stdinchi: | 1S/C25H21F3N2O/c1-24(2,31)20-6-4-3-5-19(20)17-10-13-21-22(15-17)30-23(29-21)14-9-16-7-11-18(12-8-16)25(26,27)28/h3-15,31H,1-2H3,(H,29,30)/b14-9+ |
| Stdinchikey: | ORDHXXHTBUZRCN-NTEUORMPSA-N |
| Smiles: | CC(C)(C1=CC=CC=C1C2=CC3=C(C=C2)N=C(N3)/C=C/C4=CC=C(C=C4)C(F)(F)F)O |
Mavatrep (JNJ‐39439335) is a TRPV1 receptor selective competitive antagonist.[1] It is an investigational analgesic that may be a potential treatment for pain and/or inflammation.
Phase I trials have been completed in healthy Japanese and Caucasian volunteers.[2]
Potential common adverse effects include thermohypoesthesia, chills, feeling cold, and feeling hot.
When administered orally once a day, mavatrep reached steady-state in healthy volunteers in approximately 14 days. It has a relatively long half life between 68 and 101 hours in Japanese subjects and between 82 and 130 hours in Caucasian subjects.
Mavatrep is largely eliminated non-renally. Mavatrep appears to be metabolized into two primary metabolites which are also eliminated nonrenally.