| Class: | Antineoplastic agents |
| Atc Prefix: | L01 |
| Atc Suffix: | XX77 |
| Cas Number: | 2621928-55-8 |
| Pubchem: | 156124857 |
| Chemspiderid: | 114876735 |
| Unii: | DU32DM9CHD |
| Chembl: | 4858364 |
| Pdb Ligand: | 6IC |
| Iupac Name: | 4-(4-(3,8-Diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(((2R,7aS)-2-fluorohexahydro-1H-pyrrolizin-7a-yl)methoxy)pyrido[4,3-d]pyrimidin-7-yl)-5-ethynyl-6-fluoronaphthalen-2-ol |
| C: | 33 |
| H: | 31 |
| F: | 3 |
| N: | 6 |
| O: | 2 |
| Smiles: | C#CC1=C(C=CC2=CC(=CC(=C21)C3=NC=C4C(=C3F)N=C(N=C4N5CC6CCC(C5)N6)OC[C@@]78CCCN7C[C@@H](C8)F)O)F |
| Stdinchi: | InChI=1S/C33H31F3N6O2/c1-2-23-26(35)7-4-18-10-22(43)11-24(27(18)23)29-28(36)30-25(13-37-29)31(41-15-20-5-6-21(16-41)38-20)40-32(39-30)44-17-33-8-3-9-42(33)14-19(34)12-33/h1,4,7,10-11,13,19-21,38,43H,3,5-6,8-9,12,14-17H2/t19-,20?,21?,33+/m1/s1 |
| Stdinchikey: | SCLLZBIBSFTLIN-IFMUVJFISA-N |
MRTX1133 is an investigational drug that targets the G12D mutation in KRAS dependent cancers.[1] [2] It is currently in a phase 1/2 clinical trial for the treatment of solid tumors.