| Class: | Antineoplastic agents |
| Atc Prefix: | L01 |
| Atc Suffix: | XX77 |
| Cas Number: | 2621928-55-8 |
| Pubchem: | 156124857 |
| Chemspiderid: | 114876735 |
| Unii: | DU32DM9CHD |
| Chembl: | 4858364 |
| Pdb Ligand: | 6IC |
| Iupac Name: | 4-(4-(3,8-Diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(((2R,7aS)-2-fluorohexahydro-1H-pyrrolizin-7a-yl)methoxy)pyrido[4,3-d]pyrimidin-7-yl)-5-ethynyl-6-fluoronaphthalen-2-ol |
| C: | 33 |
| H: | 31 |
| F: | 3 |
| N: | 6 |
| O: | 2 |
| Smiles: | C#CC1=C(C=CC2=CC(=CC(=C21)C3=NC=C4C(=C3F)N=C(N=C4N5CC6CCC(C5)N6)OC[C@@]78CCCN7C[C@@H](C8)F)O)F |
| Stdinchi: | InChI=1S/C33H31F3N6O2/c1-2-23-26(35)7-4-18-10-22(43)11-24(27(18)23)29-28(36)30-25(13-37-29)31(41-15-20-5-6-21(16-41)38-20)40-32(39-30)44-17-33-8-3-9-42(33)14-19(34)12-33/h1,4,7,10-11,13,19-21,38,43H,3,5-6,8-9,12,14-17H2/t19-,20?,21?,33+/m1/s1 |
| Stdinchikey: | SCLLZBIBSFTLIN-IFMUVJFISA-N |
MRTX1133 is an investigational drug that targets the G12D mutation in KRAS dependent cancers.[1] [2] It is currently in a phase 1/2 clinical trial for the treatment of solid tumors. MRTX1133 is considered to be harmful from direct skin or eye exposure other than transient irritation. It may cause irritation of the respiratory system if inhaled.[3]