| Iupac Name: | methyl (2S)-2-[(1-butylindazole-3-carbonyl)amino]-3,3-dimethylbutanoate |
| Width: | 200px |
| Pubchem: | 165361538 |
| Chemspiderid: | 79413388 |
| Unii: | AN7ERQ8YHM |
| Smiles: | CCCCN1C2=CC=CC=C2C(=N1)C(=O)N[C@H](C(=O)OC)C(C)(C)C |
| C: | 19 |
| H: | 27 |
| N: | 3 |
| O: | 3 |
| Stdinchi: | 1S/C19H27N3O3/c1-6-7-12-22-14-11-9-8-10-13(14)15(21-22)17(23)20-16(18(24)25-5)19(2,3)4/h8-11,16H,6-7,12H2,1-5H3,(H,20,23)/t16-/m1/s1 |
| Stdinchikey: | YHAWFWPNIXPRDT-MRXNPFEDSA-N |
MDMB-BINACA (MDMB-BUTINACA) is an indazole-3-carboxamide based synthetic cannabinoid receptor agonist that has been sold as a designer drug, first identified in Sweden in May 2023. It has a similar chemical structure to potent cannabinoid agonists previously reported such as ADB-BUTINACA and MDMB-5'Br-BUTINACA, and is believed to have similar effects.[1]