| Drug Name: | Methylbutyltryptamine |
| Cas Number: | 848130-12-1 |
| Unii: | UQ2K8W783S |
| Pubchem: | 44719457 |
| Chemspiderid: | 21106349 |
| Dtxsid: | DTXSID501016744 |
| Iupac Name: | N-[2-(1''H''-indol-3-yl)ethyl]-N-methylbutan-1-amine |
| C: | 15 |
| H: | 22 |
| N: | 2 |
| Smiles: | CCCCN(C)CCC1=CNC2=CC=CC=C21 |
| Stdinchi: | 1S/C15H22N2/c1-3-4-10-17(2)11-9-13-12-16-15-8-6-5-7-14(13)15/h5-8,12,16H,3-4,9-11H2,1-2H3 |
| Stdinchikey: | PUEYINPKMCBJCA-UHFFFAOYSA-N |
MBT, or N-methyl-N-butyltryptamine, is a lesser-known psychedelic drug. MBT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), the minimum dosage is listed as 250-400 mg, and the duration listed as 4–6 hours. MBT produces a heavy body load with dehydration, and causes visuals similar to those of DMT. Very little data exists about the pharmacological properties, metabolism, and toxicity of MBT.
TiHKAL mentions that a structural isomer of MBT exists, with the butyl group attached at the nitrogen atom. It is known as N-s-butyl-N-methyltryptamine, or MSBT. However, little is known about its psychoactivity.