| Iupac Name: | 6-(oxy)-N-methyl-1-naphthamide |
| Routes Of Administration: | By mouth |
| Legal Status: | Investigational |
| Elimination Half-Life: | 31–40 hrs |
| Cas Number: | 1058137-23-7 |
| Atc Prefix: | None |
| Pubchem: | 25031915 |
| Chemspiderid: | 28189586 |
| Unii: | PP449XA4BH |
| Kegg: | D11762 |
| Chebi: | 65209 |
| Chembl: | 2180605 |
| Synonyms: | CO-3810, E-3810 |
| C: | 26 |
| H: | 25 |
| N: | 3 |
| O: | 4 |
| Smiles: | CNC(=O)c1cccc2c1ccc(c2)Oc3ccnc4c3cc(c(c4)OCC5(CC5)N)OC |
| Stdinchi: | 1S/C26H25N3O4/c1-28-25(30)19-5-3-4-16-12-17(6-7-18(16)19)33-22-8-11-29-21-14-24(23(31-2)13-20(21)22)32-15-26(27)9-10-26/h3-8,11-14H,9-10,15,27H2,1-2H3,(H,28,30) |
| Stdinchikey: | CUDVHEFYRIWYQD-UHFFFAOYSA-N |
Lucitanib (INN) is a drug that is being investigated by Clovis Oncology in clinical trials for the treatment of advanced solid tumours[1] including metastatic breast cancer. It is a protein kinase inhibitor that blocks the VEGF receptors 1, 2 and 3, as well as the fibroblast growth factor receptors 1 and 2, and the platelet-derived growth factor receptors alpha and beta.