Drug Name: | JTK-109 |
C: | 37 |
H: | 33 |
Cl: | 1 |
F: | 1 |
N: | 3 |
O: | 4 |
Iupac Name: | 2-[4-[[2-(4-chlorophenyl)-5-(2-oxopyrrolidin-1-yl)phenyl]methoxy]-2-fluorophenyl]-1-cyclohexylbenzimidazole-5-carboxylic acid| CAS_number = 480462-62-2| ChEMBL = 210297| DrugBank = | ChemSpiderID = 9860746| PubChem = 11686018| UNII = BJA28665XS | smiles = C1CCC(CC1)N2C3=C(C=C(C=C3)C(=O)O)N=C2C4=C(C=C(C=C4)OCC5=C(C=CC(=C5)N6CCCC6=O)C7=CC=C(C=C7)Cl)F| StdInChI= 1S/C37H33ClFN3O4/c38-26-11-8-23(9-12-26)30-15-13-28(41-18-4-7-35(41)43)19-25(30)22-46-29-14-16-31(32(39)21-29)36-40-33-20-24(37(44)45)10-17-34(33)42(36)27-5-2-1-3-6-27/h8-17,19-21,27H,1-7,18,22H2,(H,44,45)| StdInChIKey = NIBYCXOKANETJM-UHFFFAOYSA-N}} JTK-109 is an antiviral drug which acts as a NS5B RNA-dependent RNA polymerase inhibitor. It was initially developed for the treatment of Hepatitis C, but also shows activity against caliciviruses such as norovirus.[1] [2] [3] [4] References} |