| Tradename: | Solu-Cortef |
| Dailymedid: | Hydrocortisone sodium succinate |
| Routes Of Administration: | Intravenous, intramuscular |
| Class: | Corticosteroid |
| Atc Prefix: | A01 |
| Atc Suffix: | AC03 |
| Legal Au: | S4 |
| Legal Au Comment: | [1] |
| Legal Us: | Rx-only |
| Legal Us Comment: | [2] |
| Cas Number: | 125-04-2 |
| Pubchem: | 23694214 |
| Drugbank: | DBSALT001297 |
| Chemspiderid: | 390144 |
| Unii: | 50LQB69S1Z |
| Kegg: | D00978 |
| Chebi: | 5782 |
| Chembl: | 1200495 |
| Iupac Name: | Sodium 4-[2-[(8''S'',9''S'',10''R'',11''S'',13''S'',14''S'',17''R'')-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1''H''-cyclopenta[''a'']phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoate |
| C: | 25 |
| H: | 34 |
| O: | 8 |
| Na: | 1 |
| Smiles: | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)COC(=O)CCC(=O)[O-])O)C)O.[Na+] |
| Stdinchi: | 1S/C25H34O8.Na/c1-23-9-7-15(26)11-14(23)3-4-16-17-8-10-25(32,24(17,2)12-18(27)22(16)23)19(28)13-33-21(31)6-5-20(29)30;/h11,16-18,22,27,32H,3-10,12-13H2,1-2H3,(H,29,30);/q;+1/p-1/t16-,17-,18-,22+,23-,24-,25-;/m0./s1 |
| Stdinchikey: | HHZQLQREDATOBM-CODXZCKSSA-M |
Hydrocortisone sodium succinate, sold under the brand name Solu-Cortef among others, is a synthetic glucocorticoid corticosteroid and a corticosteroid ester.[3]
Hydrocortisone sodium succinate was approved for medical use in the United States in 1955.