| Verifiedfields: | changed |
| Watchedfields: | changed |
| Verifiedrevid: | 461770217 |
| Legal Status: | Rx only |
| Cas Number: | 87-00-3 |
| Atc Prefix: | S01 |
| Atc Suffix: | FA05 |
| Pubchem: | 6321423 |
| Drugbank: | DB00725 |
| Chemspiderid: | 16498795 |
| Unii: | 8QS6WCL55Z |
| Chembl: | 1233442 |
| Iupac Name: | (N-Methyl-8-azabicyclo[3.2.1]oct-3-yl) 2-hydroxy-2-phenylacetate |
| C: | 16 |
| H: | 21 |
| N: | 1 |
| O: | 3 |
| Smiles: | CN3[C@H]1CC[C@@H]3C[C@@H](C1)OC(=O)C(O)c2ccccc2 |
| Stdinchi: | 1S/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3/t12-,13+,14+,15? |
| Stdinchikey: | ZTVIKZXZYLEVOL-MCOXGKPRSA-N |
Homatropine (Equipin, Isopto Homatropine) is an anticholinergic medication that is an antagonist at muscarinic acetylcholine receptors and thus the parasympathetic nervous system. It is used in eye drops as a cycloplegic (to temporarily paralyze accommodation), and as a mydriatic (to dilate the pupil).
The related chemical compound homatropine methylbromide (methylhomatropine) is a different medication. Homatropine is less potent than atropine and has a shorter duration of action. It is available as the hydrobromide salt. Homatropine is also given as an atropine substitute,[1] given to reverse the muscarinic and CNS effects associated with indirect cholinomimetic (anti-AChase) administration.
Homatropine hydrobromide is on the World Health Organization's List of Essential Medicines.[2]