| Atc Prefix: | None |
| Cas Number: | 2170729-29-8 |
| Pubchem: | 132260161 |
| Unii: | 6JLQ8K35KK |
| Drugbank: | DB16707 |
| Synonyms: | AT-007 |
| Chemspiderid: | 81409264 |
| Chembl: | 4650327 |
| Stdinchi: | 1S/C17H10F3N3O3S2/c18-17(19,20)8-1-2-13-12(3-8)21-14(28-13)5-23-16(26)10-7-27-6-9(10)11(22-23)4-15(24)25/h1-3,6-7H,4-5H2,(H,24,25) |
| Stdinchikey: | ORQGHAJIWGGFJK-UHFFFAOYSA-N |
| Smiles: | C1=CC2=C(C=C1C(F)(F)F)N=C(S2)CN3C(=O)C4=CSC=C4C(=N3)CC(=O)O |
| Iupac Name: | 2-[4-Oxo-3-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]thieno[3,4-d]pyridazin-1-yl]acetic acid |
| C: | 17 |
| H: | 10 |
| F: | 3 |
| N: | 3 |
| O: | 3 |
| S: | 2 |
Govorestat (AT-007) is an aldose reductase inhibitor and experimental drug to treat galactosemia[1] and sorbitol dehydrogenase deficiency.[2]
After a report circulating on the internet accused the developer Applied Therapeutics of cutting corners in its studies of the drug, the FDA put a hold on it in 2020. Applied Therapeutics said that the report was a fraudulent attempt to manipulate its stock price.[3]