| Iupac Name: | N-[(3-Fluoro-4-<nowiki/>{[2-(5-<nowiki/>{[(2-methoxyethyl)amino]methyl}-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxy}phenyl)carbamothioyl]-2-(4-fluorophenyl)acetamide |
| Routes Of Administration: | By mouth |
| Legal Status: | Investigational |
| Cas Number: | 936694-12-1 |
| Atc Prefix: | None |
| Pubchem: | 25181472 |
| Chemspiderid: | 52084900 |
| Unii: | 7Q29OXD98N |
| Kegg: | D11136 |
| C: | 31 |
| H: | 27 |
| F: | 2 |
| N: | 5 |
| O: | 3 |
| S: | 2 |
| Smiles: | COCCNCc1ccc(nc1)c2cc3c(s2)c(ccn3)Oc4ccc(cc4F)NC(=S)NC(=O)Cc5ccc(cc5)F |
| Stdinchi: | 1S/C31H27F2N5O3S2/c1-40-13-12-34-17-20-4-8-24(36-18-20)28-16-25-30(43-28)27(10-11-35-25)41-26-9-7-22(15-23(26)33)37-31(42)38-29(39)14-19-2-5-21(32)6-3-19/h2-11,15-16,18,34H,12-14,17H2,1H3,(H2,37,38,39,42) |
| Stdinchikey: | YRCHYHRCBXNYNU-UHFFFAOYSA-N |
Glesatinib (MGCD265) is an experimental anti-cancer drug.[1] [2]
It is in phase 2 clinical trials for non-small cell lung cancer (NSCLC).
It is a spectrum selective tyrosine[1] kinase inhibitor "for the treatment of non-small cell lung cancer (NSCLC) patients with genetic alterations of MET".[3]