| Iupac Name: | 3-(4-Chloro-2-fluorobenzyl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)-8-(morpholinomethyl)imidazo[1,2-''b'']pyridazin-6-amine |
| Routes Of Administration: | PO |
| Cas Number: | 1229236-86-5 |
| Unii: | ANC71R916O |
| Atc Prefix: | none |
| Pubchem: | 46213929 |
| Chemspiderid: | 25027412 |
| Kegg: | D10365 |
| C: | 23 |
| H: | 25 |
| Cl: | 1 |
| F: | 1 |
| N: | 7 |
| O: | 1 |
| Smiles: | C12C(=CC(=NN1C(=C(N=2)C)CC1C(=CC(=CC=1)Cl)F)NC1=NNC(=C1)C)CN1CCOCC1 |
| Stdinchi: | 1S/C23H25ClFN7O/c1-14-9-21(29-28-14)27-22-11-17(13-31-5-7-33-8-6-31)23-26-15(2)20(32(23)30-22)10-16-3-4-18(24)12-19(16)25/h3-4,9,11-12H,5-8,10,13H2,1-2H3,(H2,27,28,29,30) |
| Stdinchikey: | SQSZANZGUXWJEA-UHFFFAOYSA-N |
Gandotinib (LY-2784544) is an experimental drug developed by Eli Lilly for treatment of cancer. It is a small molecule JAK2 (Janus kinase) inhibitor, with additional minor inhibition of STAT3.
In phase I trial, 16% of patients receiving the drug developed tumor lysis syndrome.[1] A phase II trial is underway for patients with myeloproliferative neoplasms, polycythemia vera, essential thrombocythemia, or myelofibrosis, who had failed ruxolitinib.[2]