| Tradename: | Nailin |
| Atc Prefix: | D01 |
| Atc Suffix: | BA03 |
| Legal Status: | Rx-only |
| Cas Number: | 351227-64-0 |
| Pubchem: | 9807507 |
| Unii: | L4Q6O5430L |
| Kegg: | D10762 |
| Synonyms: | BMS-379224; BFE-1224; E-1224 |
| Stdinchi: | 1S/C23H20F2N5O5PS/c1-15(22-29-21(10-37-22)17-4-2-16(9-26)3-5-17)23(11-30-13-27-12-28-30,34-14-35-36(31,32)33)19-7-6-18(24)8-20(19)25/h2-8,10,12-13,15H,11,14H2,1H3,(H2,31,32,33)/t15-,23+/m0/s1 |
| Stdinchikey: | SYTNEMZCCLUTNX-NPMXOYFQSA-N |
| Iupac Name: | [(2''R'',3''R'')-3-[4-(4-Cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl dihydrogen phosphate |
| C: | 23 |
| H: | 20 |
| F: | 2 |
| N: | 5 |
| O: | 5 |
| P: | 1 |
| S: | 1 |
| Smiles: | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@@](Cn1cncn1)(OCOP(=O)(O)O)c1ccc(F)cc1F |
Fosravuconazole (trade name Nailin) is a triazole antifungal agent.[1] [2] In Japan, it is approved for the treatment of onychomycosis, a fungal infection of the nail.[3] It is a prodrug that is converted into ravuconazole.[1]
Drugs for Neglected Diseases Initiative (DNDi) and the Japanese pharmaceutical company Eisai found that fosravuconazole works as a treatment for mycetoma, a serious condition.[1] [4] [5] The Phase II clinical trial found that oral fosravuconazole was safe, patient-friendly, and effective in treating eumycetoma.[6] [7] Eumycetoma mainly affects young adults in poorer, rural areas; the standard treatment is itraconazole, which is much more expensive at about US$2,000 for a year than fosravuconazole and unaffordable, and not available in all endemic countries.[7]