| Legal Status: | Investigational |
| Synonyms: | GSK3640254 |
| Cas Number: | 1818867-24-1 |
| Pubchem: | 118435805 |
| Unii: | M5FP5REG5Q |
| Kegg: | D12523 |
| Iupac Name: | (1R)-4-[(1''R'',3a''S'',5a''R'',5b''R'',7a''R'',11a''S'',11b''R'',13a''R'',13b''R'')-3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[''a'']chrysen-9-yl]-1-(fluoromethyl)cyclohex-3-ene-1-carboxylic acid |
| Smiles: | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@H]4[C@]([C@@]3(CC2)C)(CC[C@@H]5[C@@]4(CC=C(C5(C)C)C6=CC[C@@](CC6)(CF)C(=O)O)C)C)NCCN7CCS(=O)(=O)CC7 |
| Stdinchi: | 1S/C43H67FN2O4S/c1-29(2)31-12-19-43(45-22-23-46-24-26-51(49,50)27-25-46)21-20-40(6)33(36(31)43)8-9-35-39(5)15-13-32(38(3,4)34(39)14-16-41(35,40)7)30-10-17-42(28-44,18-11-30)37(47)48/h10,13,31,33-36,45H,1,8-9,11-12,14-28H2,2-7H3,(H,47,48)/t31-,33+,34-,35+,36+,39-,40+,41+,42+,43-/m0/s1 |
| Stdinchikey: | YFSNREBZTKMFEB-DHGHKPCRSA-N |
| C: | 43 |
| H: | 67 |
| F: | 1 |
| N: | 2 |
| O: | 4 |
| S: | 1 |
Fipravirimat is an experimental drug for the treatment of HIV/AIDS. It belongs to a class of drugs known as maturation inhibitors.[1] [2]
Fipravirimat was being developed by ViiV Healthcare, but development was stopped in 2023.[3]