| Iupac Name: | (3R)-4-[(3''R'')-3-Amino-4-(2,4,5-trifluorophenyl)butanoyl]-3--2-piperazinone |
| Tradename: | Suganon |
| Routes Of Administration: | By mouth |
| Cas Number: | 1222102-29-5 |
| Atc Prefix: | A10 |
| Atc Suffix: | BH07 |
| Pubchem: | 25022354 |
| Chemspiderid: | 26339341 |
| Unii: | 09118300L7 |
| Chembl: | 1779710 |
| Kegg: | D11023 |
| Synonyms: | DA-1229 |
| C: | 19 |
| H: | 26 |
| F: | 3 |
| N: | 3 |
| O: | 3 |
| Smiles: | CC(C)(C)OC[C@@H]1C(=O)NCCN1C(=O)C[C@@H](Cc2cc(c(cc2F)F)F)N |
| Stdinchi: | 1S/C19H26F3N3O3/c1-19(2,3)28-10-16-18(27)24-4-5-25(16)17(26)8-12(23)6-11-7-14(21)15(22)9-13(11)20/h7,9,12,16H,4-6,8,10,23H2,1-3H3,(H,24,27)/t12-,16-/m1/s1 |
| Stdinchikey: | LCDDAGSJHKEABN-MLGOLLRUSA-N |
Evogliptin (INN; trade names Suganon, Evodine) is an antidiabetic drug in the dipeptidyl peptidase-4 (DPP-4) inhibitor or "gliptin" class of drugs.[1] It was developed by the South Korean pharmaceutical company Dong-A ST and is approved for use in South Korea[2] and Russia.[3] In a meta-analysis involving data from 6 randomized controlled trials (887 patients), Dutta et. al. demonstrated the good glycaemic efficacy and safety of this medicine as compared to other DPP4 inhibitors like sitagliptin and linagliptin. [4]