| Width: | 250px |
| Cas Number: | 633-36-3 |
| Pubchem: | 101811 |
| Chemspiderid: | 91987 |
| Unii: | EV7SH765LS |
| Synonyms: | EDC; Estradiol 3,17β-dicypionate; Estradiol dicipionate; Estradiol dicyclopentylpropionate; Estradiol dicyclopentanepropionate; Estra-1,3,5(10)-triene-3,17β-diol 3,17β-di(cyclopentanepropionate) |
| Iupac Name: | [(8''R'',9''S'',13''S'',14''S'',17''S'')-3-(3-cyclopentylpropanoyloxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[''a'']phenanthren-17-yl] 3-cyclopentylpropanoate |
| C: | 34 |
| H: | 48 |
| O: | 4 |
| Smiles: | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC(=O)CCC4CCCC4)CCC5=C3C=CC(=C5)OC(=O)CCC6CCCC6 |
| Stdinchi: | 1S/C34H48O4/c1-34-21-20-28-27-15-13-26(37-32(35)18-10-23-6-2-3-7-23)22-25(27)12-14-29(28)30(34)16-17-31(34)38-33(36)19-11-24-8-4-5-9-24/h13,15,22-24,28-31H,2-12,14,16-21H2,1H3/t28-,29-,30+,31+,34+/m1/s1 |
| Stdinchikey: | PVDLDDBZCWVZBX-FTWOUWFXSA-N |
Estradiol dicypionate (EDC), also known as estradiol 3,17β-dicypionate, is an estrogen ester which was never marketed.[1] It is the C3 and C17β cypionate (cyclopentylpropionate) diester of estradiol.